C17H14F3NO4 — CID 22292598
4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione (PubChem CID 22292598) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione.
| Compound Name | 4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione |
|---|---|
| PubChem CID | 22292598 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4,7-dimethyl-2-[3-(trifluoromethyl)phenyl]-6,7a-dihydro-3aH-4,7-epoxyisoindole-1,3,5-trione |
| SMILES | CC12CC(=O)C(C)(O1)C1C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)C12 |
| InChI | InChI=1S/C17H14F3NO4/c1-15-7-10(22)16(2,25-15)12-11(15)13(23)21(14(12)24)9-5-3-4-8(6-9)17(18,19)20/h3-6,11-12H,7H2,1-2H3 |
| InChIKey | USGBYPHAAYELNX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|