C18H19N3O3 — CID 58757305
(3aS,5S,7aR)-5-amino-2-(4-isocyano-3-methylphenyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58757305) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (3aS,5S,7aR)-5-amino-2-(4-isocyano-3-methylphenyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,5S,7aR)-5-amino-2-(4-isocyano-3-methylphenyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58757305 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (3aS,5S,7aR)-5-amino-2-(4-isocyano-3-methylphenyl)-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)OC3(C)C[C@@H]2N)cc1C |
| InChI | InChI=1S/C18H19N3O3/c1-9-7-10(5-6-11(9)20-4)21-15(22)13-14(16(21)23)18(3)12(19)8-17(13,2)24-18/h5-7,12-14H,8,19H2,1-3H3/t12-,13-,14+,17?,18?/m0/s1 |
| InChIKey | KUCDCNVZGGKVPT-SHEHLUNASA-N |
| XLogP | 1.93 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|