C18H17FN2O4 — CID 70917578
4-[(3aS,5S,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile (PubChem CID 70917578) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is 4-[(3aS,5S,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile.
| Compound Name | 4-[(3aS,5S,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 70917578 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-[(3aS,5S,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile |
| SMILES | CC12C[C@H](O)C(C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(CF)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C18H17FN2O4/c1-17-6-12(22)18(2,25-17)14-13(17)15(23)21(16(14)24)11-4-3-9(8-20)10(5-11)7-19/h3-5,12-14,22H,6-7H2,1-2H3/t12-,13-,14+,17?,18?/m0/s1 |
| InChIKey | SWRRSHVQPOTPGH-SHEHLUNASA-N |
| XLogP | 1.45 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|