C16H15N3O5 — CID 10125806
(3aR,5S,7aS)-2-(2,1,3-benzoxadiazol-5-yl)-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 10125806) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is (3aR,5S,7aS)-2-(2,1,3-benzoxadiazol-5-yl)-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,5S,7aS)-2-(2,1,3-benzoxadiazol-5-yl)-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 10125806 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (3aR,5S,7aS)-2-(2,1,3-benzoxadiazol-5-yl)-5-hydroxy-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC12C[C@H](O)C(C)(O1)[C@@H]1C(=O)N(c3ccc4nonc4c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H15N3O5/c1-15-6-10(20)16(2,23-15)12-11(15)13(21)19(14(12)22)7-3-4-8-9(5-7)18-24-17-8/h3-5,10-12,20H,6H2,1-2H3/t10-,11+,12-,15?,16?/m0/s1 |
| InChIKey | QSIWSSIJUORLMJ-DGWNHINDSA-N |
| XLogP | 0.64 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|