C18H17F3N2O4S — CID 58746032
4-[(3aR,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 58746032) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-[(3aR,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-[(3aR,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 58746032 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 4-[(3aR,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC12C[C@H](O)C(C)(O1)[C@@H]1C(=O)N(c3ccc(C(N)=S)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H17F3N2O4S/c1-16-6-10(24)17(2,27-16)12-11(16)14(25)23(15(12)26)7-3-4-8(13(22)28)9(5-7)18(19,20)21/h3-5,10-12,24H,6H2,1-2H3,(H2,22,28)/t10-,11+,12-,16?,17?/m0/s1 |
| InChIKey | CXGIGWZWCWLAEE-KHNNNQPQSA-N |
| XLogP | 1.76 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|