C18H16F3N3O6S — CID 162578967
[(3aS,5R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] sulfamate (PubChem CID 162578967) has the molecular formula C18H16F3N3O6S and a molecular weight of 459.40 g/mol. Its IUPAC name is [(3aS,5R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] sulfamate.
| Compound Name | [(3aS,5R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] sulfamate |
|---|---|
| PubChem CID | 162578967 |
| Molecular Formula | C18H16F3N3O6S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | [(3aS,5R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl] sulfamate |
| SMILES | CC12C[C@@H](OS(N)(=O)=O)C(C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C12 |
| InChI | InChI=1S/C18H16F3N3O6S/c1-16-6-11(29-31(23,27)28)17(2,30-16)13-12(16)14(25)24(15(13)26)9-4-3-8(7-22)10(5-9)18(19,20)21/h3-5,11-13H,6H2,1-2H3,(H2,23,27,28)/t11-,12?,13-,16?,17?/m1/s1 |
| InChIKey | KJKCNPVXAUEIMJ-VTNXODOLSA-N |
| XLogP | 1.22 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|