C20H20F3N3O5S — CID 10195470
(3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethyl-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-sulfonamide (PubChem CID 10195470) has the molecular formula C20H20F3N3O5S and a molecular weight of 471.46 g/mol. Its IUPAC name is (3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethyl-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-sulfonamide.
| Compound Name | (3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethyl-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 10195470 |
| Molecular Formula | C20H20F3N3O5S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (3aR,5R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-N-ethyl-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-5-sulfonamide |
| SMILES | CCNS(=O)(=O)[C@@H]1CC2(C)OC1(C)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H20F3N3O5S/c1-4-25-32(29,30)13-8-18(2)14-15(19(13,3)31-18)17(28)26(16(14)27)11-6-5-10(9-24)12(7-11)20(21,22)23/h5-7,13-15,25H,4,8H2,1-3H3/t13-,14-,15+,18?,19?/m1/s1 |
| InChIKey | PNDNYQOMSZYRCC-UMWKCDSESA-N |
| XLogP | 1.94 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|