C19H15F5N2O4 — CID 71020681
4-[(3aR,5S,7aS)-5-(difluoromethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 71020681) has the molecular formula C19H15F5N2O4 and a molecular weight of 430.33 g/mol. Its IUPAC name is 4-[(3aR,5S,7aS)-5-(difluoromethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,5S,7aS)-5-(difluoromethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71020681 |
| Molecular Formula | C19H15F5N2O4 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 4-[(3aR,5S,7aS)-5-(difluoromethoxy)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12C[C@H](OC(F)F)C(C)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H15F5N2O4/c1-17-6-11(29-16(20)21)18(2,30-17)13-12(17)14(27)26(15(13)28)9-4-3-8(7-25)10(5-9)19(22,23)24/h3-5,11-13,16H,6H2,1-2H3/t11-,12+,13-,17?,18?/m0/s1 |
| InChIKey | IOPJHXPOISQJDF-MMJUYHKESA-N |
| XLogP | 3.24 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|