C22H22F3N3O5 — CID 70917398
propyl N-[(3aS,4R,5S,7R,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate (PubChem CID 70917398) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is propyl N-[(3aS,4R,5S,7R,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate.
| Compound Name | propyl N-[(3aS,4R,5S,7R,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate |
|---|---|
| PubChem CID | 70917398 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | propyl N-[(3aS,4R,5S,7R,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate |
| SMILES | CCCOC(=O)N[C@H]1C[C@@]2(C)O[C@]1(C)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H22F3N3O5/c1-4-7-32-19(31)27-14-9-20(2)15-16(21(14,3)33-20)18(30)28(17(15)29)12-6-5-11(10-26)13(8-12)22(23,24)25/h5-6,8,14-16H,4,7,9H2,1-3H3,(H,27,31)/t14-,15-,16+,20+,21-/m0/s1 |
| InChIKey | FVZZRVSQPQJQRB-HACTYUDJSA-N |
| XLogP | 3.14 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|