C22H24FN3O4 — CID 71020736
N-[(3aR,5R,7aS)-2-[4-cyano-3-(fluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-2-methylpropanamide (PubChem CID 71020736) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[(3aR,5R,7aS)-2-[4-cyano-3-(fluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-2-methylpropanamide.
| Compound Name | N-[(3aR,5R,7aS)-2-[4-cyano-3-(fluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71020736 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[(3aR,5R,7aS)-2-[4-cyano-3-(fluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@@H]1CC2(C)OC1(C)[C@@H]1C(=O)N(c3ccc(C#N)c(CF)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C22H24FN3O4/c1-11(2)18(27)25-15-8-21(3)16-17(22(15,4)30-21)20(29)26(19(16)28)14-6-5-12(10-24)13(7-14)9-23/h5-7,11,15-17H,8-9H2,1-4H3,(H,25,27)/t15-,16-,17+,21?,22?/m1/s1 |
| InChIKey | SSPBHPZXYCSEQO-WKUAPKQTSA-N |
| XLogP | 2.23 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|