C20H18FN3O3 — CID 71020600
4-[(3aR,7aS)-4-(2-cyanoethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile (PubChem CID 71020600) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is 4-[(3aR,7aS)-4-(2-cyanoethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,7aS)-4-(2-cyanoethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71020600 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-[(3aR,7aS)-4-(2-cyanoethyl)-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(fluoromethyl)benzonitrile |
| SMILES | CC12CCC(CCC#N)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(CF)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H18FN3O3/c1-19-6-7-20(27-19,5-2-8-22)16-15(19)17(25)24(18(16)26)14-4-3-12(11-23)13(9-14)10-21/h3-4,9,15-16H,2,5-7,10H2,1H3/t15-,16+,19?,20?/m1/s1 |
| InChIKey | MCCHNHRYTWYCBD-ZNVHBHFFSA-N |
| XLogP | 2.76 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|