C27H23F3N2O6 — CID 68906156
methyl 4-[2-[(3aR,4R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]benzoate (PubChem CID 68906156) has the molecular formula C27H23F3N2O6 and a molecular weight of 528.48 g/mol. Its IUPAC name is methyl 4-[2-[(3aR,4R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[(3aR,4R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 68906156 |
| Molecular Formula | C27H23F3N2O6 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | methyl 4-[2-[(3aR,4R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC[C@@]23CC[C@@](C)(O2)[C@H]2C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C27H23F3N2O6/c1-25-9-10-26(38-25,11-12-37-18-7-4-15(5-8-18)24(35)36-2)21-20(25)22(33)32(23(21)34)17-6-3-16(14-31)19(13-17)27(28,29)30/h3-8,13,20-21H,9-12H2,1-2H3/t20-,21+,25-,26-/m1/s1 |
| InChIKey | JYYDTAXYRDHHGD-WSAILGMDSA-N |
| XLogP | 4.26 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|