C29H29F3N4O6 — CID 140512906
ethyl N-[4-[2-[(6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethoxy]phenyl]carbamate (PubChem CID 140512906) has the molecular formula C29H29F3N4O6 and a molecular weight of 586.57 g/mol. Its IUPAC name is ethyl N-[4-[2-[(6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethoxy]phenyl]carbamate.
| Compound Name | ethyl N-[4-[2-[(6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 140512906 |
| Molecular Formula | C29H29F3N4O6 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | ethyl N-[4-[2-[(6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethoxy]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(OCCN2CC3(C)O[C@](C)(C2)[C@@H]2C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)C23)cc1 |
| InChI | InChI=1S/C29H29F3N4O6/c1-4-40-26(39)34-18-6-9-20(10-7-18)41-12-11-35-15-27(2)22-23(28(3,16-35)42-27)25(38)36(24(22)37)19-8-5-17(14-33)21(13-19)29(30,31)32/h5-10,13,22-23H,4,11-12,15-16H2,1-3H3,(H,34,39)/t22-,23?,27+,28?/m0/s1 |
| InChIKey | HEBLYCKWCCMKPQ-HAXDVDQLSA-N |
| XLogP | 4.19 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|