C26H27F8N3O4S — CID 163442842
4-[(6S,7S)-1,7-dimethyl-3,5-dioxo-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 163442842) has the molecular formula C26H27F8N3O4S and a molecular weight of 629.57 g/mol. Its IUPAC name is 4-[(6S,7S)-1,7-dimethyl-3,5-dioxo-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(6S,7S)-1,7-dimethyl-3,5-dioxo-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 163442842 |
| Molecular Formula | C26H27F8N3O4S |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 4-[(6S,7S)-1,7-dimethyl-3,5-dioxo-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12CN(CCCS(=O)CCCC(F)(F)C(F)(F)F)C[C@@](C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C12 |
| InChI | InChI=1S/C26H27F8N3O4S/c1-22-13-36(8-4-10-42(40)9-3-7-24(27,28)26(32,33)34)14-23(2,41-22)19-18(22)20(38)37(21(19)39)16-6-5-15(12-35)17(11-16)25(29,30)31/h5-6,11,18-19H,3-4,7-10,13-14H2,1-2H3/t18-,19?,22-,23?,42?/m1/s1 |
| InChIKey | AZZPJAVVULLVGH-JGWWKHRHSA-N |
| XLogP | 4.66 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|