C31H32F3N3O5 — CID 70997404
benzyl 6-[(1R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]hexanoate (PubChem CID 70997404) has the molecular formula C31H32F3N3O5 and a molecular weight of 583.61 g/mol. Its IUPAC name is benzyl 6-[(1R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]hexanoate.
| Compound Name | benzyl 6-[(1R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]hexanoate |
|---|---|
| PubChem CID | 70997404 |
| Molecular Formula | C31H32F3N3O5 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | benzyl 6-[(1R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]hexanoate |
| SMILES | C[C@]12CN(CCCCCC(=O)OCc3ccccc3)C[C@](C)(O1)C1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C12 |
| InChI | InChI=1S/C31H32F3N3O5/c1-29-18-36(14-8-4-7-11-24(38)41-17-20-9-5-3-6-10-20)19-30(2,42-29)26-25(29)27(39)37(28(26)40)22-13-12-21(16-35)23(15-22)31(32,33)34/h3,5-6,9-10,12-13,15,25-26H,4,7-8,11,14,17-19H2,1-2H3/t25?,26?,29-,30+ |
| InChIKey | QNTBMNXRNZQYFR-CBFLYABFSA-N |
| XLogP | 4.85 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|