C27H24F3N5O6 — CID 70995928
2-[(1S,2R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]-N-[(4-nitrophenyl)methyl]acetamide (PubChem CID 70995928) has the molecular formula C27H24F3N5O6 and a molecular weight of 571.51 g/mol. Its IUPAC name is 2-[(1S,2R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]-N-[(4-nitrophenyl)methyl]acetamide.
| Compound Name | 2-[(1S,2R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]-N-[(4-nitrophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 70995928 |
| Molecular Formula | C27H24F3N5O6 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 2-[(1S,2R,7R)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]-N-[(4-nitrophenyl)methyl]acetamide |
| SMILES | C[C@]12CN(CC(=O)NCc3ccc([N+](=O)[O-])cc3)C[C@](C)(O1)C1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H24F3N5O6/c1-25-13-33(12-20(36)32-11-15-3-6-17(7-4-15)35(39)40)14-26(2,41-25)22-21(25)23(37)34(24(22)38)18-8-5-16(10-31)19(9-18)27(28,29)30/h3-9,21-22H,11-14H2,1-2H3,(H,32,36)/t21-,22?,25+,26-/m0/s1 |
| InChIKey | JJGLCVRVAYTNPR-INJCZIGSSA-N |
| XLogP | 2.77 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|