C28H35F3N6O4 — CID 70995907
4-[2-[(1R,2S,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethyl]-N-propan-2-ylpiperazine-1-carboxamide (PubChem CID 70995907) has the molecular formula C28H35F3N6O4 and a molecular weight of 576.62 g/mol. Its IUPAC name is 4-[2-[(1R,2S,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethyl]-N-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[(1R,2S,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethyl]-N-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 70995907 |
| Molecular Formula | C28H35F3N6O4 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 4-[2-[(1R,2S,6R,7S)-4-[4-cyano-3-(trifluoromethyl)phenyl]-1,7-dimethyl-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-9-yl]ethyl]-N-propan-2-ylpiperazine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCN(CCN2C[C@@]3(C)O[C@@](C)(C2)[C@H]2C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)[C@H]23)CC1 |
| InChI | InChI=1S/C28H35F3N6O4/c1-17(2)33-25(40)36-11-9-34(10-12-36)7-8-35-15-26(3)21-22(27(4,16-35)41-26)24(39)37(23(21)38)19-6-5-18(14-32)20(13-19)28(29,30)31/h5-6,13,17,21-22H,7-12,15-16H2,1-4H3,(H,33,40)/t21-,22+,26+,27- |
| InChIKey | ILBSYIAGQMPIEG-KWUUDPFMSA-N |
| XLogP | 2.28 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|