C26H23F3N4O6 — CID 71201280
4-[(1R,2S,6R,7S)-1,7-dimethyl-9-[2-(4-nitrophenoxy)ethyl]-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 71201280) has the molecular formula C26H23F3N4O6 and a molecular weight of 544.49 g/mol. Its IUPAC name is 4-[(1R,2S,6R,7S)-1,7-dimethyl-9-[2-(4-nitrophenoxy)ethyl]-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,2S,6R,7S)-1,7-dimethyl-9-[2-(4-nitrophenoxy)ethyl]-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 71201280 |
| Molecular Formula | C26H23F3N4O6 |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 4-[(1R,2S,6R,7S)-1,7-dimethyl-9-[2-(4-nitrophenoxy)ethyl]-3,5-dioxo-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12CN(CCOc3ccc([N+](=O)[O-])cc3)C[C@](C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H23F3N4O6/c1-24-13-31(9-10-38-18-7-5-16(6-8-18)33(36)37)14-25(2,39-24)21-20(24)22(34)32(23(21)35)17-4-3-15(12-30)19(11-17)26(27,28)29/h3-8,11,20-21H,9-10,13-14H2,1-2H3/t20-,21+,24+,25- |
| InChIKey | FVMNMHXRZJBHOA-NYSUNNPDSA-N |
| XLogP | 3.53 |
| TPSA | 126.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|