C25H21F3N2O4 — CID 68537899
4-[(3aR,4S,7S,7aS)-4-methyl-1,3-dioxo-7-(2-phenoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 68537899) has the molecular formula C25H21F3N2O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is 4-[(3aR,4S,7S,7aS)-4-methyl-1,3-dioxo-7-(2-phenoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4S,7S,7aS)-4-methyl-1,3-dioxo-7-(2-phenoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 68537899 |
| Molecular Formula | C25H21F3N2O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-[(3aR,4S,7S,7aS)-4-methyl-1,3-dioxo-7-(2-phenoxyethyl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@@]12CC[C@@](CCOc3ccccc3)(O1)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C25H21F3N2O4/c1-23-9-10-24(34-23,11-12-33-17-5-3-2-4-6-17)20-19(23)21(31)30(22(20)32)16-8-7-15(14-29)18(13-16)25(26,27)28/h2-8,13,19-20H,9-12H2,1H3/t19-,20+,23-,24-/m0/s1 |
| InChIKey | KOFRJKUDRNDYLQ-KZTDQWPFSA-N |
| XLogP | 4.47 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|