C24H18F4N2O3 — CID 68537808
4-[(3aR,4R,7R,7aS)-4-[(4-fluorophenyl)methyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 68537808) has the molecular formula C24H18F4N2O3 and a molecular weight of 458.41 g/mol. Its IUPAC name is 4-[(3aR,4R,7R,7aS)-4-[(4-fluorophenyl)methyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4R,7R,7aS)-4-[(4-fluorophenyl)methyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 68537808 |
| Molecular Formula | C24H18F4N2O3 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-[(3aR,4R,7R,7aS)-4-[(4-fluorophenyl)methyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12CC[C@](Cc3ccc(F)cc3)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H18F4N2O3/c1-22-8-9-23(33-22,11-13-2-5-15(25)6-3-13)19-18(22)20(31)30(21(19)32)16-7-4-14(12-29)17(10-16)24(26,27)28/h2-7,10,18-19H,8-9,11H2,1H3/t18-,19+,22-,23-/m1/s1 |
| InChIKey | QDTBFECWXJAKJN-IYRWYFENSA-N |
| XLogP | 4.39 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|