C27H24F3N3O5 — CID 69382009
N-[4-[2-[(3aR,4R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]phenyl]acetamide (PubChem CID 69382009) has the molecular formula C27H24F3N3O5 and a molecular weight of 527.50 g/mol. Its IUPAC name is N-[4-[2-[(3aR,4R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]phenyl]acetamide.
| Compound Name | N-[4-[2-[(3aR,4R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 69382009 |
| Molecular Formula | C27H24F3N3O5 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-[4-[2-[(3aR,4R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC[C@@]23CCC(C)(O2)[C@H]2C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C27H24F3N3O5/c1-15(34)32-17-4-7-19(8-5-17)37-12-11-26-10-9-25(2,38-26)21-22(26)24(36)33(23(21)35)18-6-3-16(14-31)20(13-18)27(28,29)30/h3-8,13,21-22H,9-12H2,1-2H3,(H,32,34)/t21-,22+,25?,26-/m1/s1 |
| InChIKey | YEMDNXOUVHXERQ-IRGRDRIXSA-N |
| XLogP | 4.43 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|