C26H27F8N3O4S — CID 91299667
4-[(1S,7R)-3,5-dihydroxy-1,7-dimethyl-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 91299667) has the molecular formula C26H27F8N3O4S and a molecular weight of 629.57 g/mol. Its IUPAC name is 4-[(1S,7R)-3,5-dihydroxy-1,7-dimethyl-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,7R)-3,5-dihydroxy-1,7-dimethyl-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 91299667 |
| Molecular Formula | C26H27F8N3O4S |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 4-[(1S,7R)-3,5-dihydroxy-1,7-dimethyl-9-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12CN(CCCS(=O)CCCC(F)(F)C(F)(F)F)C[C@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C26H27F8N3O4S/c1-22-13-36(8-4-10-42(40)9-3-7-24(27,28)26(32,33)34)14-23(2,41-22)19-18(22)20(38)37(21(19)39)16-6-5-15(12-35)17(11-16)25(29,30)31/h5-6,11,38-39H,3-4,7-10,13-14H2,1-2H3/t22-,23+,42? |
| InChIKey | WYEGYKVFRMXOJZ-FOGMRFMGSA-N |
| XLogP | 5.67 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|