C24H28F3N3O4 — CID 90934918
4-[(1S,7R)-3,5-dihydroxy-9-(6-hydroxyhexyl)-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90934918) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is 4-[(1S,7R)-3,5-dihydroxy-9-(6-hydroxyhexyl)-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,7R)-3,5-dihydroxy-9-(6-hydroxyhexyl)-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90934918 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 4-[(1S,7R)-3,5-dihydroxy-9-(6-hydroxyhexyl)-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12CN(CCCCCCO)C[C@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C24H28F3N3O4/c1-22-13-29(9-5-3-4-6-10-31)14-23(2,34-22)19-18(22)20(32)30(21(19)33)16-8-7-15(12-28)17(11-16)24(25,26)27/h7-8,11,31-33H,3-6,9-10,13-14H2,1-2H3/t22-,23+ |
| InChIKey | ARJXXHWIUYNXEU-ZRZAMGCNSA-N |
| XLogP | 4.11 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|