C26H25F3N4O4 — CID 91479128
4-[9-[2-(4-aminophenoxy)ethyl]-3,5-dihydroxy-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 91479128) has the molecular formula C26H25F3N4O4 and a molecular weight of 514.50 g/mol. Its IUPAC name is 4-[9-[2-(4-aminophenoxy)ethyl]-3,5-dihydroxy-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[9-[2-(4-aminophenoxy)ethyl]-3,5-dihydroxy-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 91479128 |
| Molecular Formula | C26H25F3N4O4 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 4-[9-[2-(4-aminophenoxy)ethyl]-3,5-dihydroxy-1,7-dimethyl-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12CN(CCOc3ccc(N)cc3)CC(C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C26H25F3N4O4/c1-24-13-32(9-10-36-18-7-4-16(31)5-8-18)14-25(2,37-24)21-20(24)22(34)33(23(21)35)17-6-3-15(12-30)19(11-17)26(27,28)29/h3-8,11,34-35H,9-10,13-14,31H2,1-2H3 |
| InChIKey | FAVVQRASMGRSMN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|