C18H15F3N2O5 — CID 90944588
4-[(4S,5S,6S,7R)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90944588) has the molecular formula C18H15F3N2O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is 4-[(4S,5S,6S,7R)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4S,5S,6S,7R)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90944588 |
| Molecular Formula | C18H15F3N2O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-[(4S,5S,6S,7R)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12O[C@](C)(c3c1c(O)n(-c1ccc(C#N)c(C(F)(F)F)c1)c3O)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C18H15F3N2O5/c1-16-10-11(17(2,28-16)13(25)12(16)24)15(27)23(14(10)26)8-4-3-7(6-22)9(5-8)18(19,20)21/h3-5,12-13,24-27H,1-2H3/t12-,13-,16-,17+/m0/s1 |
| InChIKey | JADWGULESSTGDJ-MGBSGCIJSA-N |
| XLogP | 1.97 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |