C24H29F3N2O4Si — CID 91176014
4-[(4R,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 91176014) has the molecular formula C24H29F3N2O4Si and a molecular weight of 494.59 g/mol. Its IUPAC name is 4-[(4R,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 91176014 |
| Molecular Formula | C24H29F3N2O4Si |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 4-[(4R,5R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@]2(C)O[C@]1(C)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C24H29F3N2O4Si/c1-21(2,3)34(6,7)32-16-11-22(4)17-18(23(16,5)33-22)20(31)29(19(17)30)14-9-8-13(12-28)15(10-14)24(25,26)27/h8-10,16,30-31H,11H2,1-7H3/t16-,22-,23+/m1/s1 |
| InChIKey | DUSPXYOXWQUZGK-AVIJNYRZSA-N |
| XLogP | 6.03 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|