C26H33F3N2O5Si — CID 90963423
4-[(4S,5R,7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90963423) has the molecular formula C26H33F3N2O5Si and a molecular weight of 538.64 g/mol. Its IUPAC name is 4-[(4S,5R,7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4S,5R,7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90963423 |
| Molecular Formula | C26H33F3N2O5Si |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-[(4S,5R,7S)-7-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@]12C[C@@H](O)[C@@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C26H33F3N2O5Si/c1-23(2,3)37(5,6)35-11-7-10-25-13-18(32)24(4,36-25)19-20(25)22(34)31(21(19)33)16-9-8-15(14-30)17(12-16)26(27,28)29/h8-9,12,18,32-34H,7,10-11,13H2,1-6H3/t18-,24-,25+/m1/s1 |
| InChIKey | WNTMDJALNGJLST-XYHYBEPMSA-N |
| XLogP | 5.79 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|