C19H17F3N2O6 — CID 91202925
4-[(4R,5S,6R,7S)-1,3,5,6-tetrahydroxy-4-(2-hydroxyethyl)-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 91202925) has the molecular formula C19H17F3N2O6 and a molecular weight of 426.35 g/mol. Its IUPAC name is 4-[(4R,5S,6R,7S)-1,3,5,6-tetrahydroxy-4-(2-hydroxyethyl)-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R,5S,6R,7S)-1,3,5,6-tetrahydroxy-4-(2-hydroxyethyl)-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 91202925 |
| Molecular Formula | C19H17F3N2O6 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 4-[(4R,5S,6R,7S)-1,3,5,6-tetrahydroxy-4-(2-hydroxyethyl)-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12O[C@](CCO)(c3c1c(O)n(-c1ccc(C#N)c(C(F)(F)F)c1)c3O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C19H17F3N2O6/c1-17-11-12(18(30-17,4-5-25)14(27)13(17)26)16(29)24(15(11)28)9-3-2-8(7-23)10(6-9)19(20,21)22/h2-3,6,13-14,25-29H,4-5H2,1H3/t13-,14+,17+,18-/m1/s1 |
| InChIKey | KGISUYLTXSBNEQ-IDCJVQTKSA-N |
| XLogP | 1.34 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |