C17H13F3N2O4 — CID 91045445
2-(trifluoromethyl)-4-[(4S,7S)-1,3,5-trihydroxy-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindol-2-yl]benzonitrile (PubChem CID 91045445) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[(4S,7S)-1,3,5-trihydroxy-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindol-2-yl]benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-[(4S,7S)-1,3,5-trihydroxy-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 91045445 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-(trifluoromethyl)-4-[(4S,7S)-1,3,5-trihydroxy-7-methyl-5,6-dihydro-4H-4,7-epoxyisoindol-2-yl]benzonitrile |
| SMILES | C[C@@]12CC(O)[C@@H](O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C17H13F3N2O4/c1-16-5-10(23)13(26-16)11-12(16)15(25)22(14(11)24)8-3-2-7(6-21)9(4-8)17(18,19)20/h2-4,10,13,23-25H,5H2,1H3/t10?,13-,16+/m1/s1 |
| InChIKey | CPCBDFRNXCLHGX-BVPGBDNSSA-N |
| XLogP | 2.83 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |