C29H36N2O5Si — CID 90829307
4-[(4S,5R,7S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethyl-1,3,5-trihydroxy-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 90829307) has the molecular formula C29H36N2O5Si and a molecular weight of 520.70 g/mol. Its IUPAC name is 4-[(4S,5R,7S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethyl-1,3,5-trihydroxy-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(4S,5R,7S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethyl-1,3,5-trihydroxy-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 90829307 |
| Molecular Formula | C29H36N2O5Si |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 4-[(4S,5R,7S)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-ethyl-1,3,5-trihydroxy-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | CC[C@@]12O[C@@](CCO[Si](C)(C)C(C)(C)C)(C[C@H]1O)c1c2c(O)n(-c2ccc(C#N)c3ccccc23)c1O |
| InChI | InChI=1S/C29H36N2O5Si/c1-7-29-22(32)16-28(36-29,14-15-35-37(5,6)27(2,3)4)23-24(29)26(34)31(25(23)33)21-13-12-18(17-30)19-10-8-9-11-20(19)21/h8-13,22,32-34H,7,14-16H2,1-6H3/t22-,28+,29-/m1/s1 |
| InChIKey | SSDLJWHETVGLKZ-MXUAVAHLSA-N |
| XLogP | 5.92 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|