C25H21F3N4O4 — CID 91141078
1-[(4S,5R,7S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl]-3-phenylurea (PubChem CID 91141078) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is 1-[(4S,5R,7S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl]-3-phenylurea.
| Compound Name | 1-[(4S,5R,7S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 91141078 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-[(4S,5R,7S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl]-3-phenylurea |
| SMILES | C[C@@]12O[C@@](C)(C[C@H]1NC(=O)Nc1ccccc1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C25H21F3N4O4/c1-23-11-17(31-22(35)30-14-6-4-3-5-7-14)24(2,36-23)19-18(23)20(33)32(21(19)34)15-9-8-13(12-29)16(10-15)25(26,27)28/h3-10,17,33-34H,11H2,1-2H3,(H2,30,31,35)/t17-,23+,24-/m1/s1 |
| InChIKey | GZOHGJWGGPATBG-GAZXMLTASA-N |
| XLogP | 4.83 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |