C17H14F3N3O5 — CID 91151385
5-[(4R,5R,6R,7S)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 91151385) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is 5-[(4R,5R,6R,7S)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[(4R,5R,6R,7S)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 91151385 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 5-[(4R,5R,6R,7S)-1,3,5,6-tetrahydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | C[C@]12O[C@](C)(c3c1c(O)n(-c1cnc(C#N)c(C(F)(F)F)c1)c3O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C17H14F3N3O5/c1-15-9-10(16(2,28-15)12(25)11(15)24)14(27)23(13(9)26)6-3-7(17(18,19)20)8(4-21)22-5-6/h3,5,11-12,24-27H,1-2H3/t11-,12-,15-,16+/m1/s1 |
| InChIKey | PJQZCKXMOIUZFK-BHTHQVBYSA-N |
| XLogP | 1.37 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |