C19H15F3N2O6 — CID 91064358
(4R,5S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-4,7-dimethyl-6H-4,7-epoxyisoindole-5-carboxylic acid (PubChem CID 91064358) has the molecular formula C19H15F3N2O6 and a molecular weight of 424.33 g/mol. Its IUPAC name is (4R,5S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-4,7-dimethyl-6H-4,7-epoxyisoindole-5-carboxylic acid.
| Compound Name | (4R,5S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-4,7-dimethyl-6H-4,7-epoxyisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 91064358 |
| Molecular Formula | C19H15F3N2O6 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (4R,5S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-4,7-dimethyl-6H-4,7-epoxyisoindole-5-carboxylic acid |
| SMILES | C[C@]12C[C@@](O)(C(=O)O)[C@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C19H15F3N2O6/c1-16-7-18(29,15(27)28)17(2,30-16)12-11(16)13(25)24(14(12)26)9-4-3-8(6-23)10(5-9)19(20,21)22/h3-5,25-26,29H,7H2,1-2H3,(H,27,28)/t16-,17-,18-/m1/s1 |
| InChIKey | DTYLRCIREHORNV-KZNAEPCWSA-N |
| XLogP | 2.46 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |