C20H18F3N3O5 — CID 90932021
(5S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-N,4,7-trimethyl-6H-4,7-epoxyisoindole-5-carboxamide (PubChem CID 90932021) has the molecular formula C20H18F3N3O5 and a molecular weight of 437.37 g/mol. Its IUPAC name is (5S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-N,4,7-trimethyl-6H-4,7-epoxyisoindole-5-carboxamide.
| Compound Name | (5S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-N,4,7-trimethyl-6H-4,7-epoxyisoindole-5-carboxamide |
|---|---|
| PubChem CID | 90932021 |
| Molecular Formula | C20H18F3N3O5 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (5S)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,5-trihydroxy-N,4,7-trimethyl-6H-4,7-epoxyisoindole-5-carboxamide |
| SMILES | CNC(=O)[C@]1(O)CC2(C)OC1(C)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C20H18F3N3O5/c1-17-8-19(30,16(29)25-3)18(2,31-17)13-12(17)14(27)26(15(13)28)10-5-4-9(7-24)11(6-10)20(21,22)23/h4-6,27-28,30H,8H2,1-3H3,(H,25,29)/t17?,18?,19-/m1/s1 |
| InChIKey | OPJOCTRBFDDDDN-CTWPCTMYSA-N |
| XLogP | 2.12 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |