C21H16F3N5O5S — CID 91448516
4-[3,5-dihydroxy-1,7-dimethyl-9-(5-nitro-1,3-thiazol-2-yl)-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 91448516) has the molecular formula C21H16F3N5O5S and a molecular weight of 507.45 g/mol. Its IUPAC name is 4-[3,5-dihydroxy-1,7-dimethyl-9-(5-nitro-1,3-thiazol-2-yl)-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3,5-dihydroxy-1,7-dimethyl-9-(5-nitro-1,3-thiazol-2-yl)-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 91448516 |
| Molecular Formula | C21H16F3N5O5S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 4-[3,5-dihydroxy-1,7-dimethyl-9-(5-nitro-1,3-thiazol-2-yl)-11-oxa-4,9-diazatricyclo[5.3.1.02,6]undeca-2,5-dien-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12CN(c3ncc([N+](=O)[O-])s3)CC(C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C21H16F3N5O5S/c1-19-8-27(18-26-7-13(35-18)29(32)33)9-20(2,34-19)15-14(19)16(30)28(17(15)31)11-4-3-10(6-25)12(5-11)21(22,23)24/h3-5,7,30-31H,8-9H2,1-2H3 |
| InChIKey | DIRUGOQAPDUXLH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|