C21H19F3N2O6 — CID 59635991
2-[(3aS,4S,5R,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethyl acetate (PubChem CID 59635991) has the molecular formula C21H19F3N2O6 and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-[(3aS,4S,5R,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethyl acetate.
| Compound Name | 2-[(3aS,4S,5R,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethyl acetate |
|---|---|
| PubChem CID | 59635991 |
| Molecular Formula | C21H19F3N2O6 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-[(3aS,4S,5R,7S,7aR)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-4-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@]12O[C@@](C)(C[C@H]1O)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H19F3N2O6/c1-10(27)31-6-5-20-14(28)8-19(2,32-20)15-16(20)18(30)26(17(15)29)12-4-3-11(9-25)13(7-12)21(22,23)24/h3-4,7,14-16,28H,5-6,8H2,1-2H3/t14-,15+,16-,19+,20-/m1/s1 |
| InChIKey | FMEOFUSSIPMWIU-VQEGESQYSA-N |
| XLogP | 1.93 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|