C20H19F3N2O5 — CID 142266925
4-[(2S,6S,9R)-9-hydroxy-9-(hydroxymethyl)-1,8-dimethyl-3,5-dioxo-11-oxa-4-azatricyclo[6.2.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 142266925) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is 4-[(2S,6S,9R)-9-hydroxy-9-(hydroxymethyl)-1,8-dimethyl-3,5-dioxo-11-oxa-4-azatricyclo[6.2.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(2S,6S,9R)-9-hydroxy-9-(hydroxymethyl)-1,8-dimethyl-3,5-dioxo-11-oxa-4-azatricyclo[6.2.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 142266925 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-[(2S,6S,9R)-9-hydroxy-9-(hydroxymethyl)-1,8-dimethyl-3,5-dioxo-11-oxa-4-azatricyclo[6.2.1.02,6]undecan-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC12C[C@@](O)(CO)C(C)(C[C@@H]3C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4)C(=O)[C@@H]31)O2 |
| InChI | InChI=1S/C20H19F3N2O5/c1-17-8-19(29,9-26)18(2,30-17)6-12-14(17)16(28)25(15(12)27)11-4-3-10(7-24)13(5-11)20(21,22)23/h3-5,12,14,26,29H,6,8-9H2,1-2H3/t12-,14+,17?,18?,19+/m0/s1 |
| InChIKey | KVZBEKVVUUWWCL-RTPMBXFJSA-N |
| XLogP | 1.75 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|