C19H15F3N2O6 — CID 58745911
(3aR,5S,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-1,3-dioxo-6,7a-dihydro-3aH-4,7-epoxyisoindole-5-carboxylic acid (PubChem CID 58745911) has the molecular formula C19H15F3N2O6 and a molecular weight of 424.33 g/mol. Its IUPAC name is (3aR,5S,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-1,3-dioxo-6,7a-dihydro-3aH-4,7-epoxyisoindole-5-carboxylic acid.
| Compound Name | (3aR,5S,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-1,3-dioxo-6,7a-dihydro-3aH-4,7-epoxyisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 58745911 |
| Molecular Formula | C19H15F3N2O6 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (3aR,5S,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-4,7-dimethyl-1,3-dioxo-6,7a-dihydro-3aH-4,7-epoxyisoindole-5-carboxylic acid |
| SMILES | CC12C[C@@](O)(C(=O)O)C(C)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H15F3N2O6/c1-16-7-18(29,15(27)28)17(2,30-16)12-11(16)13(25)24(14(12)26)9-4-3-8(6-23)10(5-9)19(20,21)22/h3-5,11-12,29H,7H2,1-2H3,(H,27,28)/t11-,12+,16?,17?,18-/m1/s1 |
| InChIKey | KSHHCGNIPMHVBZ-OIGQPYSYSA-N |
| XLogP | 1.45 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|