C20H17N3O4 — CID 158463714
5-[(3aS,4S,5S,7R,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 158463714) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-[(3aS,4S,5S,7R,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(3aS,4S,5S,7R,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 158463714 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-[(3aS,4S,5S,7R,7aR)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@]12O[C@](C)(C[C@@H]1O)[C@@H]1C(=O)N(c3ccc(C#N)c4ncccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H17N3O4/c1-19-8-13(24)20(2,27-19)15-14(19)17(25)23(18(15)26)12-6-5-10(9-21)16-11(12)4-3-7-22-16/h3-7,13-15,24H,8H2,1-2H3/t13-,14-,15+,19+,20+/m0/s1 |
| InChIKey | HFMKKTHSUWOXGK-KSMAZPFSSA-N |
| XLogP | 1.52 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|