C28H22N4O6 — CID 10239280
5-[(3aS,5R,7aR)-7-[2-(1,2-benzoxazol-3-yloxy)ethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 10239280) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is 5-[(3aS,5R,7aR)-7-[2-(1,2-benzoxazol-3-yloxy)ethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(3aS,5R,7aR)-7-[2-(1,2-benzoxazol-3-yloxy)ethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 10239280 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 5-[(3aS,5R,7aR)-7-[2-(1,2-benzoxazol-3-yloxy)ethyl]-5-hydroxy-4-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | CC12OC(CCOc3noc4ccccc34)(C[C@H]1O)[C@@H]1C(=O)N(c3ccc(C#N)c4ncccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C28H22N4O6/c1-27-20(33)13-28(38-27,10-12-36-24-17-5-2-3-7-19(17)37-31-24)22-21(27)25(34)32(26(22)35)18-9-8-15(14-29)23-16(18)6-4-11-30-23/h2-9,11,20-22,33H,10,12-13H2,1H3/t20-,21-,22+,27?,28?/m1/s1 |
| InChIKey | MTNXXFLGDOQRLP-STWHLOTBSA-N |
| XLogP | 3.11 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|