C19H18F3N3O3 — CID 170262492
4-[(3aR,4R,5R,7R,7aS)-5-amino-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-methyl-2-(trifluoromethyl)benzonitrile (PubChem CID 170262492) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 4-[(3aR,4R,5R,7R,7aS)-5-amino-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-methyl-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3aR,4R,5R,7R,7aS)-5-amino-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-methyl-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 170262492 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[(3aR,4R,5R,7R,7aS)-5-amino-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-methyl-2-(trifluoromethyl)benzonitrile |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(C)C[C@@H](N)[C@]3(C)O2)ccc(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C19H18F3N3O3/c1-8-10(5-4-9(7-23)12(8)19(20,21)22)25-15(26)13-14(16(25)27)18(3)11(24)6-17(13,2)28-18/h4-5,11,13-14H,6,24H2,1-3H3/t11-,13-,14+,17-,18+/m1/s1 |
| InChIKey | WCXNLJHRAAYUKU-DRDFSMPYSA-N |
| XLogP | 2.27 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|