C24H27F4N3O5S — CID 170263165
2-(trimethyl-λ4-sulfanyl)ethyl N-[(3aR,4R,5R,7R,7aS)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate (PubChem CID 170263165) has the molecular formula C24H27F4N3O5S and a molecular weight of 545.56 g/mol. Its IUPAC name is 2-(trimethyl-λ4-sulfanyl)ethyl N-[(3aR,4R,5R,7R,7aS)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate.
| Compound Name | 2-(trimethyl-λ4-sulfanyl)ethyl N-[(3aR,4R,5R,7R,7aS)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate |
|---|---|
| PubChem CID | 170263165 |
| Molecular Formula | C24H27F4N3O5S |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 2-(trimethyl-λ4-sulfanyl)ethyl N-[(3aR,4R,5R,7R,7aS)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]carbamate |
| SMILES | C[C@]12O[C@](C)(C[C@H]1NC(=O)OCCS(C)(C)C)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3F)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H27F4N3O5S/c1-22-10-14(30-21(34)35-8-9-37(3,4)5)23(2,36-22)17-16(22)19(32)31(20(17)33)13-7-6-12(11-29)15(18(13)25)24(26,27)28/h6-7,14,16-17H,8-10H2,1-5H3,(H,30,34)/t14-,16-,17+,22-,23+/m1/s1 |
| InChIKey | GKOQJEHZUJVHRV-REXYXRLHSA-N |
| XLogP | 3.56 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|