C23H20F4N2O7 — CID 156861358
2-methoxyethoxymethyl (3aS,4S,7S,7aR)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindole-5-carboxylate (PubChem CID 156861358) has the molecular formula C23H20F4N2O7 and a molecular weight of 512.41 g/mol. Its IUPAC name is 2-methoxyethoxymethyl (3aS,4S,7S,7aR)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindole-5-carboxylate.
| Compound Name | 2-methoxyethoxymethyl (3aS,4S,7S,7aR)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindole-5-carboxylate |
|---|---|
| PubChem CID | 156861358 |
| Molecular Formula | C23H20F4N2O7 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2-methoxyethoxymethyl (3aS,4S,7S,7aR)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindole-5-carboxylate |
| SMILES | COCCOCOC(=O)C1=C[C@]2(C)O[C@@]1(C)[C@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3F)C(=O)[C@H]12 |
| InChI | InChI=1S/C23H20F4N2O7/c1-21-8-12(20(32)35-10-34-7-6-33-3)22(2,36-21)16-15(21)18(30)29(19(16)31)13-5-4-11(9-28)14(17(13)24)23(25,26)27/h4-5,8,15-16H,6-7,10H2,1-3H3/t15-,16+,21-,22+/m0/s1 |
| InChIKey | ZOEUYOIBXOQPGN-VYXDICFBSA-N |
| XLogP | 2.47 |
| TPSA | 115.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|