C28H32N2O4Si — CID 23395018
4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 23395018) has the molecular formula C28H32N2O4Si and a molecular weight of 488.66 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 23395018 |
| Molecular Formula | C28H32N2O4Si |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-7-methyl-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@]12C=C[C@@](C)(O1)[C@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C28H32N2O4Si/c1-26(2,3)35(5,6)33-16-15-28-14-13-27(4,34-28)22-23(28)25(32)30(24(22)31)21-12-11-18(17-29)19-9-7-8-10-20(19)21/h7-14,22-23H,15-16H2,1-6H3/t22-,23+,27-,28-/m1/s1 |
| InChIKey | OVIAWQHRVUGSLH-ATRCONBKSA-N |
| XLogP | 5.33 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|