C24H21F4N5O5 — CID 170263173
N-[(3aS,4S,5S,7S)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide (PubChem CID 170263173) has the molecular formula C24H21F4N5O5 and a molecular weight of 535.45 g/mol. Its IUPAC name is N-[(3aS,4S,5S,7S)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(3aS,4S,5S,7S)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 170263173 |
| Molecular Formula | C24H21F4N5O5 |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-[(3aS,4S,5S,7S)-2-[4-cyano-2-fluoro-3-(trifluoromethyl)phenyl]-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-5-yl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(O)c1cc(C(=O)N[C@H]2C[C@]3(C)O[C@@]2(C)[C@H]2C(=O)N(c4ccc(C#N)c(C(F)(F)F)c4F)C(=O)C23)n[nH]1 |
| InChI | InChI=1S/C24H21F4N5O5/c1-9(34)11-6-12(32-31-11)19(35)30-14-7-22(2)16-17(23(14,3)38-22)21(37)33(20(16)36)13-5-4-10(8-29)15(18(13)25)24(26,27)28/h4-6,9,14,16-17,34H,7H2,1-3H3,(H,30,35)(H,31,32)/t9?,14-,16?,17+,22-,23+/m0/s1 |
| InChIKey | VXKNDVNHENFCBF-IHANBLGDSA-N |
| XLogP | 2.35 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|