C18H13F3N2O5 — CID 58757308
(3aS,5S,7aR)-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylic acid (PubChem CID 58757308) has the molecular formula C18H13F3N2O5 and a molecular weight of 394.31 g/mol. Its IUPAC name is (3aS,5S,7aR)-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylic acid.
| Compound Name | (3aS,5S,7aR)-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 58757308 |
| Molecular Formula | C18H13F3N2O5 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (3aS,5S,7aR)-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylic acid |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)[C@H]3C4C[C@H](C(=O)O)C(C)(O4)[C@H]3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O5/c1-17-9(16(26)27)6-11(28-17)12-13(17)15(25)23(14(12)24)7-3-4-10(22-2)8(5-7)18(19,20)21/h3-5,9,11-13H,6H2,1H3,(H,26,27)/t9-,11?,12+,13-,17?/m1/s1 |
| InChIKey | NMVPKZCCJDJSGD-AGULLANYSA-N |
| XLogP | 2.62 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|