C21H19F3N2O5 — CID 71156575
propyl (3aR,4S,5R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylate (PubChem CID 71156575) has the molecular formula C21H19F3N2O5 and a molecular weight of 436.39 g/mol. Its IUPAC name is propyl (3aR,4S,5R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylate.
| Compound Name | propyl (3aR,4S,5R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylate |
|---|---|
| PubChem CID | 71156575 |
| Molecular Formula | C21H19F3N2O5 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | propyl (3aR,4S,5R,7R,7aS)-2-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-1,3-dioxo-5,6,7,7a-tetrahydro-3aH-4,7-epoxyisoindole-5-carboxylate |
| SMILES | CCCOC(=O)[C@@H]1C[C@H]2O[C@@]1(C)[C@@H]1C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H19F3N2O5/c1-3-6-30-19(29)13-8-14-15-16(20(13,2)31-14)18(28)26(17(15)27)11-5-4-10(9-25)12(7-11)21(22,23)24/h4-5,7,13-16H,3,6,8H2,1-2H3/t13-,14+,15+,16-,20+/m0/s1 |
| InChIKey | HKISTZXHGQEXII-BBNZOYGDSA-N |
| XLogP | 2.81 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|