C18H13F3N2O5 — CID 90988204
1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6H-4,7-epoxyisoindol-5-one (PubChem CID 90988204) has the molecular formula C18H13F3N2O5 and a molecular weight of 394.31 g/mol. Its IUPAC name is 1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6H-4,7-epoxyisoindol-5-one.
| Compound Name | 1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6H-4,7-epoxyisoindol-5-one |
|---|---|
| PubChem CID | 90988204 |
| Molecular Formula | C18H13F3N2O5 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-6H-4,7-epoxyisoindol-5-one |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)OC3(C)C(=O)C2O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O5/c1-16-10-11(17(2,28-16)13(25)12(16)24)15(27)23(14(10)26)7-4-5-9(22-3)8(6-7)18(19,20)21/h4-6,12,24,26-27H,1-2H3 |
| InChIKey | IZAZMERWQGYZPM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|