C19H17F3N2O7S — CID 91539301
[(5R,6R)-1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] methanesulfonate (PubChem CID 91539301) has the molecular formula C19H17F3N2O7S and a molecular weight of 474.41 g/mol. Its IUPAC name is [(5R,6R)-1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] methanesulfonate.
| Compound Name | [(5R,6R)-1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 91539301 |
| Molecular Formula | C19H17F3N2O7S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | [(5R,6R)-1,3,6-trihydroxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] methanesulfonate |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)OC3(C)[C@H](O)[C@H]2OS(C)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O7S/c1-17-11-12(18(2,31-17)14(13(17)25)30-32(4,28)29)16(27)24(15(11)26)8-5-6-10(23-3)9(7-8)19(20,21)22/h5-7,13-14,25-27H,1-2,4H3/t13-,14-,17?,18?/m1/s1 |
| InChIKey | VHSGJGYHVONTAN-JDPPGYRCSA-N |
| XLogP | 2.64 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|