C20H21F3N2O5Si — CID 137329510
(5R,6R)-6-dimethylsilyloxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 137329510) has the molecular formula C20H21F3N2O5Si and a molecular weight of 454.48 g/mol. Its IUPAC name is (5R,6R)-6-dimethylsilyloxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (5R,6R)-6-dimethylsilyloxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 137329510 |
| Molecular Formula | C20H21F3N2O5Si |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (5R,6R)-6-dimethylsilyloxy-2-[4-isocyano-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)OC3(C)[C@H](O)[C@H]2O[SiH](C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O5Si/c1-18-12-13(19(2,30-18)15(14(18)26)29-31(4)5)17(28)25(16(12)27)9-6-7-11(24-3)10(8-9)20(21,22)23/h6-8,14-15,26-28,31H,1-2,4-5H3/t14-,15-,18?,19?/m1/s1 |
| InChIKey | UBMBTYCSXGXHSD-QAQJPARQSA-N |
| XLogP | 3.66 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|